About 2-fluoroporphyrin
2-fluoroporphyrin (PubChem CID 66779415) has the molecular formula C20H11FN4
and a molecular weight of 326.33 g/mol. Its IUPAC name is 2-fluoroporphyrin.
Molecular Properties
| Compound Name | 2-fluoroporphyrin |
| PubChem CID | 66779415 |
| Molecular Formula | C20H11FN4 |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 2-fluoroporphyrin |
| SMILES | FC1=CC2=N/C1=C\C1=N/C(=C\C3=N/C(=C\C4=N/C(=C\2)C=C4)C=C3)C=C1 |
| InChI | InChI=1S/C20H11FN4/c21-19-10-18-9-16-4-3-14(23-16)7-12-1-2-13(22-12)8-15-5-6-17(24-15)11-20(19)25-18/h1-11H/b12-7-,13-8-,14-7-,15-8-,16-9-,17-11-,18-9-,20-11- |
| InChIKey | MVRGWTURWJTQDU-ZFGIDIDVSA-N |
| XLogP | 3.88 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-fluoroporphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroporphyrin?
The IUPAC name of 2-fluoroporphyrin (CID 66779415) is 2-fluoroporphyrin.
What is the SMILES notation for 2-fluoroporphyrin?
The canonical SMILES for 2-fluoroporphyrin is FC1=CC2=N/C1=C\C1=N/C(=C\C3=N/C(=C\C4=N/C(=C\2)C=C4)C=C3)C=C1.
What is the InChIKey of 2-fluoroporphyrin?
The InChIKey is MVRGWTURWJTQDU-ZFGIDIDVSA-N. The full InChI is InChI=1S/C20H11FN4/c21-19-10-18-9-16-4-3-14(23-16)7-12-1-2-13(22-12)8-15-5-6-17(24-15)11-20(19)25-18/h1-11H/b12-7-,13-8-,14-7-,15-8-,16-9-,17-11-,18-9-,20-11-.
What are the key properties of 2-fluoroporphyrin?
2-fluoroporphyrin has a molecular weight of 326.33 g/mol, XLogP of 3.88, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroporphyrin is sourced from PubChem (CID 66779415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).