About 5-cyclopentyl-1,3-dihydroimidazo[4,5-b]pyrazin-2-one
5-cyclopentyl-1,3-dihydroimidazo[4,5-b]pyrazin-2-one (PubChem CID 66779498) has the molecular formula C10H12N4O
and a molecular weight of 204.23 g/mol. Its IUPAC name is 5-cyclopentyl-1,3-dihydroimidazo[4,5-b]pyrazin-2-one.
Molecular Properties
| Compound Name | 5-cyclopentyl-1,3-dihydroimidazo[4,5-b]pyrazin-2-one |
| PubChem CID | 66779498 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 5-cyclopentyl-1,3-dihydroimidazo[4,5-b]pyrazin-2-one |
| SMILES | O=c1[nH]c2ncc(C3CCCC3)nc2[nH]1 |
| InChI | InChI=1S/C10H12N4O/c15-10-13-8-9(14-10)12-7(5-11-8)6-3-1-2-4-6/h5-6H,1-4H2,(H2,11,12,13,14,15) |
| InChIKey | FPOIIHFGJZFGGB-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-cyclopentyl-1,3-dihydroimidazo[4,5-b]pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopentyl-1,3-dihydroimidazo[4,5-b]pyrazin-2-one?
The IUPAC name of 5-cyclopentyl-1,3-dihydroimidazo[4,5-b]pyrazin-2-one (CID 66779498) is 5-cyclopentyl-1,3-dihydroimidazo[4,5-b]pyrazin-2-one.
What is the SMILES notation for 5-cyclopentyl-1,3-dihydroimidazo[4,5-b]pyrazin-2-one?
The canonical SMILES for 5-cyclopentyl-1,3-dihydroimidazo[4,5-b]pyrazin-2-one is O=c1[nH]c2ncc(C3CCCC3)nc2[nH]1.
What is the InChIKey of 5-cyclopentyl-1,3-dihydroimidazo[4,5-b]pyrazin-2-one?
The InChIKey is FPOIIHFGJZFGGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O/c15-10-13-8-9(14-10)12-7(5-11-8)6-3-1-2-4-6/h5-6H,1-4H2,(H2,11,12,13,14,15).
What are the key properties of 5-cyclopentyl-1,3-dihydroimidazo[4,5-b]pyrazin-2-one?
5-cyclopentyl-1,3-dihydroimidazo[4,5-b]pyrazin-2-one has a molecular weight of 204.23 g/mol, XLogP of 1.30, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopentyl-1,3-dihydroimidazo[4,5-b]pyrazin-2-one is sourced from PubChem (CID 66779498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).