About 7-chloro-2-(3,5-difluorophenyl)furo[3,2-b]pyridine
7-chloro-2-(3,5-difluorophenyl)furo[3,2-b]pyridine (PubChem CID 66779505) has the molecular formula C13H6ClF2NO
and a molecular weight of 265.65 g/mol. Its IUPAC name is 7-chloro-2-(3,5-difluorophenyl)furo[3,2-b]pyridine.
Molecular Properties
| Compound Name | 7-chloro-2-(3,5-difluorophenyl)furo[3,2-b]pyridine |
| PubChem CID | 66779505 |
| Molecular Formula | C13H6ClF2NO |
| Molecular Weight | 265.65 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 7-chloro-2-(3,5-difluorophenyl)furo[3,2-b]pyridine |
| SMILES | Fc1cc(F)cc(-c2cc3nccc(Cl)c3o2)c1 |
| InChI | InChI=1S/C13H6ClF2NO/c14-10-1-2-17-11-6-12(18-13(10)11)7-3-8(15)5-9(16)4-7/h1-6H |
| InChIKey | JSXGITTYOXANAW-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.65 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-chloro-2-(3,5-difluorophenyl)furo[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2-(3,5-difluorophenyl)furo[3,2-b]pyridine?
The IUPAC name of 7-chloro-2-(3,5-difluorophenyl)furo[3,2-b]pyridine (CID 66779505) is 7-chloro-2-(3,5-difluorophenyl)furo[3,2-b]pyridine.
What is the SMILES notation for 7-chloro-2-(3,5-difluorophenyl)furo[3,2-b]pyridine?
The canonical SMILES for 7-chloro-2-(3,5-difluorophenyl)furo[3,2-b]pyridine is Fc1cc(F)cc(-c2cc3nccc(Cl)c3o2)c1.
What is the InChIKey of 7-chloro-2-(3,5-difluorophenyl)furo[3,2-b]pyridine?
The InChIKey is JSXGITTYOXANAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6ClF2NO/c14-10-1-2-17-11-6-12(18-13(10)11)7-3-8(15)5-9(16)4-7/h1-6H.
What are the key properties of 7-chloro-2-(3,5-difluorophenyl)furo[3,2-b]pyridine?
7-chloro-2-(3,5-difluorophenyl)furo[3,2-b]pyridine has a molecular weight of 265.65 g/mol, XLogP of 4.43, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2-(3,5-difluorophenyl)furo[3,2-b]pyridine is sourced from PubChem (CID 66779505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).