C9H10O2S — CID 66779635
5-prop-2-enyl-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 66779635) has the molecular formula C9H10O2S and a molecular weight of 182.24 g/mol. Its IUPAC name is 5-prop-2-enyl-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 5-prop-2-enyl-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 66779635 |
| Molecular Formula | C9H10O2S |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | 5-prop-2-enyl-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | C=CCc1scc2c1OCCO2 |
| InChI | InChI=1S/C9H10O2S/c1-2-3-8-9-7(6-12-8)10-4-5-11-9/h2,6H,1,3-5H2 |
| InChIKey | CMZAMHZTAPEDPM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|