About [5-(aminomethyl)-3,4-ditert-butyl-2-pyridinyl]-carboxycarbamic acid
[5-(aminomethyl)-3,4-ditert-butyl-2-pyridinyl]-carboxycarbamic acid (PubChem CID 66779828) has the molecular formula C16H25N3O4
and a molecular weight of 323.39 g/mol. Its IUPAC name is [5-(aminomethyl)-3,4-ditert-butyl-2-pyridinyl]-carboxycarbamic acid.
Molecular Properties
| Compound Name | [5-(aminomethyl)-3,4-ditert-butyl-2-pyridinyl]-carboxycarbamic acid |
| PubChem CID | 66779828 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | [5-(aminomethyl)-3,4-ditert-butyl-2-pyridinyl]-carboxycarbamic acid |
| SMILES | CC(C)(C)c1c(CN)cnc(N(C(=O)O)C(=O)O)c1C(C)(C)C |
| InChI | InChI=1S/C16H25N3O4/c1-15(2,3)10-9(7-17)8-18-12(11(10)16(4,5)6)19(13(20)21)14(22)23/h8H,7,17H2,1-6H3,(H,20,21)(H,22,23) |
| InChIKey | FLZHIIQPGGEYTR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(aminomethyl)-3,4-ditert-butyl-2-pyridinyl]-carboxycarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(aminomethyl)-3,4-ditert-butyl-2-pyridinyl]-carboxycarbamic acid?
The IUPAC name of [5-(aminomethyl)-3,4-ditert-butyl-2-pyridinyl]-carboxycarbamic acid (CID 66779828) is [5-(aminomethyl)-3,4-ditert-butyl-2-pyridinyl]-carboxycarbamic acid.
What is the SMILES notation for [5-(aminomethyl)-3,4-ditert-butyl-2-pyridinyl]-carboxycarbamic acid?
The canonical SMILES for [5-(aminomethyl)-3,4-ditert-butyl-2-pyridinyl]-carboxycarbamic acid is CC(C)(C)c1c(CN)cnc(N(C(=O)O)C(=O)O)c1C(C)(C)C.
What is the InChIKey of [5-(aminomethyl)-3,4-ditert-butyl-2-pyridinyl]-carboxycarbamic acid?
The InChIKey is FLZHIIQPGGEYTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3O4/c1-15(2,3)10-9(7-17)8-18-12(11(10)16(4,5)6)19(13(20)21)14(22)23/h8H,7,17H2,1-6H3,(H,20,21)(H,22,23).
What are the key properties of [5-(aminomethyl)-3,4-ditert-butyl-2-pyridinyl]-carboxycarbamic acid?
[5-(aminomethyl)-3,4-ditert-butyl-2-pyridinyl]-carboxycarbamic acid has a molecular weight of 323.39 g/mol, XLogP of 3.30, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(aminomethyl)-3,4-ditert-butyl-2-pyridinyl]-carboxycarbamic acid is sourced from PubChem (CID 66779828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).