C40H55NO2 — CID 66779857
9-[5-methyl-2-(oxan-2-yloxy)phenyl]-3,6-bis(2,4,4-trimethylpentan-2-yl)carbazole (PubChem CID 66779857) has the molecular formula C40H55NO2 and a molecular weight of 581.89 g/mol. Its IUPAC name is 9-[5-methyl-2-(oxan-2-yloxy)phenyl]-3,6-bis(2,4,4-trimethylpentan-2-yl)carbazole.
| Compound Name | 9-[5-methyl-2-(oxan-2-yloxy)phenyl]-3,6-bis(2,4,4-trimethylpentan-2-yl)carbazole |
|---|---|
| PubChem CID | 66779857 |
| Molecular Formula | C40H55NO2 |
| Molecular Weight | 581.89 g/mol |
| Exact Mass | 581.42 |
| IUPAC Name | 9-[5-methyl-2-(oxan-2-yloxy)phenyl]-3,6-bis(2,4,4-trimethylpentan-2-yl)carbazole |
| SMILES | Cc1ccc(OC2CCCCO2)c(-n2c3ccc(C(C)(C)CC(C)(C)C)cc3c3cc(C(C)(C)CC(C)(C)C)ccc32)c1 |
| InChI | InChI=1S/C40H55NO2/c1-27-15-20-35(43-36-14-12-13-21-42-36)34(22-27)41-32-18-16-28(39(8,9)25-37(2,3)4)23-30(32)31-24-29(17-19-33(31)41)40(10,11)26-38(5,6)7/h15-20,22-24,36H,12-14,21,25-26H2,1-11H3 |
| InChIKey | NCEGSUHQEAHCHT-UHFFFAOYSA-N |
| XLogP | 11.43 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.89 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |