About 2-methylphenol;triazine
2-methylphenol;triazine (PubChem CID 66780120) has the molecular formula C10H11N3O
and a molecular weight of 189.22 g/mol. Its IUPAC name is 2-methylphenol;triazine.
Molecular Properties
| Compound Name | 2-methylphenol;triazine |
| PubChem CID | 66780120 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 2-methylphenol;triazine |
| SMILES | Cc1ccccc1O.c1cnnnc1 |
| InChI | InChI=1S/C7H8O.C3H3N3/c1-6-4-2-3-5-7(6)8;1-2-4-6-5-3-1/h2-5,8H,1H3;1-3H |
| InChIKey | RTMOGILUJKYLPF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylphenol;triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylphenol;triazine?
The IUPAC name of 2-methylphenol;triazine (CID 66780120) is 2-methylphenol;triazine.
What is the SMILES notation for 2-methylphenol;triazine?
The canonical SMILES for 2-methylphenol;triazine is Cc1ccccc1O.c1cnnnc1.
What is the InChIKey of 2-methylphenol;triazine?
The InChIKey is RTMOGILUJKYLPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C3H3N3/c1-6-4-2-3-5-7(6)8;1-2-4-6-5-3-1/h2-5,8H,1H3;1-3H.
What are the key properties of 2-methylphenol;triazine?
2-methylphenol;triazine has a molecular weight of 189.22 g/mol, XLogP of 1.57, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylphenol;triazine is sourced from PubChem (CID 66780120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).