C17H24O5 — CID 66780361
2-O-tert-butyl 8a-O-methyl 6-oxo-1,2,3,4,7,8-hexahydronaphthalene-2,8a-dicarboxylate (PubChem CID 66780361) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is 2-O-tert-butyl 8a-O-methyl 6-oxo-1,2,3,4,7,8-hexahydronaphthalene-2,8a-dicarboxylate.
| Compound Name | 2-O-tert-butyl 8a-O-methyl 6-oxo-1,2,3,4,7,8-hexahydronaphthalene-2,8a-dicarboxylate |
|---|---|
| PubChem CID | 66780361 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 2-O-tert-butyl 8a-O-methyl 6-oxo-1,2,3,4,7,8-hexahydronaphthalene-2,8a-dicarboxylate |
| SMILES | COC(=O)C12CCC(=O)C=C1CCC(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C17H24O5/c1-16(2,3)22-14(19)11-5-6-12-9-13(18)7-8-17(12,10-11)15(20)21-4/h9,11H,5-8,10H2,1-4H3 |
| InChIKey | TUNKTOOSKCQHHE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |