About 4-propyl-1,4-oxazepan-7-one
4-propyl-1,4-oxazepan-7-one (PubChem CID 66780385) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is 4-propyl-1,4-oxazepan-7-one.
Molecular Properties
| Compound Name | 4-propyl-1,4-oxazepan-7-one |
| PubChem CID | 66780385 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 4-propyl-1,4-oxazepan-7-one |
| SMILES | CCCN1CCOC(=O)CC1 |
| InChI | InChI=1S/C8H15NO2/c1-2-4-9-5-3-8(10)11-7-6-9/h2-7H2,1H3 |
| InChIKey | QQRDJMSIEWESHD-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-propyl-1,4-oxazepan-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propyl-1,4-oxazepan-7-one?
The IUPAC name of 4-propyl-1,4-oxazepan-7-one (CID 66780385) is 4-propyl-1,4-oxazepan-7-one.
What is the SMILES notation for 4-propyl-1,4-oxazepan-7-one?
The canonical SMILES for 4-propyl-1,4-oxazepan-7-one is CCCN1CCOC(=O)CC1.
What is the InChIKey of 4-propyl-1,4-oxazepan-7-one?
The InChIKey is QQRDJMSIEWESHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2/c1-2-4-9-5-3-8(10)11-7-6-9/h2-7H2,1H3.
What are the key properties of 4-propyl-1,4-oxazepan-7-one?
4-propyl-1,4-oxazepan-7-one has a molecular weight of 157.21 g/mol, XLogP of 0.65, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propyl-1,4-oxazepan-7-one is sourced from PubChem (CID 66780385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).