C26H29FN4O3 — CID 66781425
8-[(3R,4R)-1-ethyl-3-fluoropiperidin-4-yl]oxy-2-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]quinoline (PubChem CID 66781425) has the molecular formula C26H29FN4O3 and a molecular weight of 464.54 g/mol. Its IUPAC name is 8-[(3R,4R)-1-ethyl-3-fluoropiperidin-4-yl]oxy-2-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]quinoline.
| Compound Name | 8-[(3R,4R)-1-ethyl-3-fluoropiperidin-4-yl]oxy-2-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]quinoline |
|---|---|
| PubChem CID | 66781425 |
| Molecular Formula | C26H29FN4O3 |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | 8-[(3R,4R)-1-ethyl-3-fluoropiperidin-4-yl]oxy-2-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]quinoline |
| SMILES | CCN1CC[C@@H](Oc2cccc3ccc(-c4cnc5cc(OCCOC)ccn45)nc23)[C@H](F)C1 |
| InChI | InChI=1S/C26H29FN4O3/c1-3-30-11-10-23(20(27)17-30)34-24-6-4-5-18-7-8-21(29-26(18)24)22-16-28-25-15-19(9-12-31(22)25)33-14-13-32-2/h4-9,12,15-16,20,23H,3,10-11,13-14,17H2,1-2H3/t20-,23-/m1/s1 |
| InChIKey | AADYTTDFFQOMQO-NFBKMPQASA-N |
| XLogP | 4.39 |
| TPSA | 61.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|