C11H18BN3O4S — CID 66781540
2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-sulfonamide (PubChem CID 66781540) has the molecular formula C11H18BN3O4S and a molecular weight of 299.16 g/mol. Its IUPAC name is 2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-sulfonamide.
| Compound Name | 2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 66781540 |
| Molecular Formula | C11H18BN3O4S |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-sulfonamide |
| SMILES | CC1(C)OB(c2cnc(N)c(S(N)(=O)=O)c2)OC1(C)C |
| InChI | InChI=1S/C11H18BN3O4S/c1-10(2)11(3,4)19-12(18-10)7-5-8(20(14,16)17)9(13)15-6-7/h5-6H,1-4H3,(H2,13,15)(H2,14,16,17) |
| InChIKey | SXJBLRHPTZLDAB-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 117.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|