About methyl-(4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid;hydrochloride
methyl-(4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid;hydrochloride (PubChem CID 66781896) has the molecular formula C15H19ClN2O4
and a molecular weight of 326.78 g/mol. Its IUPAC name is methyl-(4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid;hydrochloride.
Molecular Properties
| Compound Name | methyl-(4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid;hydrochloride |
| PubChem CID | 66781896 |
| Molecular Formula | C15H19ClN2O4 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | methyl-(4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid;hydrochloride |
| SMILES | CN(C(=O)O)c1ccc2c(c1)C(=O)CC1(CCNCC1)O2.Cl |
| InChI | InChI=1S/C15H18N2O4.ClH/c1-17(14(19)20)10-2-3-13-11(8-10)12(18)9-15(21-13)4-6-16-7-5-15;/h2-3,8,16H,4-7,9H2,1H3,(H,19,20);1H |
| InChIKey | OXAYQAJIVOMQCT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl-(4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-(4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid;hydrochloride?
The IUPAC name of methyl-(4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid;hydrochloride (CID 66781896) is methyl-(4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid;hydrochloride.
What is the SMILES notation for methyl-(4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid;hydrochloride?
The canonical SMILES for methyl-(4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid;hydrochloride is CN(C(=O)O)c1ccc2c(c1)C(=O)CC1(CCNCC1)O2.Cl.
What is the InChIKey of methyl-(4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid;hydrochloride?
The InChIKey is OXAYQAJIVOMQCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O4.ClH/c1-17(14(19)20)10-2-3-13-11(8-10)12(18)9-15(21-13)4-6-16-7-5-15;/h2-3,8,16H,4-7,9H2,1H3,(H,19,20);1H.
What are the key properties of methyl-(4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid;hydrochloride?
methyl-(4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid;hydrochloride has a molecular weight of 326.78 g/mol, XLogP of 2.31, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-(4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)carbamic acid;hydrochloride is sourced from PubChem (CID 66781896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).