C27H24Cl2N2O7 — CID 66782477
2-[5-[[2,5-dichloro-4-[[(2S)-7-methoxy-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methoxy]benzoyl]amino]-2-methylphenyl]-2-oxoacetic acid (PubChem CID 66782477) has the molecular formula C27H24Cl2N2O7 and a molecular weight of 559.40 g/mol. Its IUPAC name is 2-[5-[[2,5-dichloro-4-[[(2S)-7-methoxy-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methoxy]benzoyl]amino]-2-methylphenyl]-2-oxoacetic acid.
| Compound Name | 2-[5-[[2,5-dichloro-4-[[(2S)-7-methoxy-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methoxy]benzoyl]amino]-2-methylphenyl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 66782477 |
| Molecular Formula | C27H24Cl2N2O7 |
| Molecular Weight | 559.40 g/mol |
| Exact Mass | 558.10 |
| IUPAC Name | 2-[5-[[2,5-dichloro-4-[[(2S)-7-methoxy-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methoxy]benzoyl]amino]-2-methylphenyl]-2-oxoacetic acid |
| SMILES | COc1ccc2c(c1)O[C@H](COc1cc(Cl)c(C(=O)Nc3ccc(C)c(C(=O)C(=O)O)c3)cc1Cl)CN2C |
| InChI | InChI=1S/C27H24Cl2N2O7/c1-14-4-5-15(8-18(14)25(32)27(34)35)30-26(33)19-10-21(29)23(11-20(19)28)37-13-17-12-31(2)22-7-6-16(36-3)9-24(22)38-17/h4-11,17H,12-13H2,1-3H3,(H,30,33)(H,34,35)/t17-/m0/s1 |
| InChIKey | VUDOPIPSYQZFIZ-KRWDZBQOSA-N |
| XLogP | 5.11 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.40 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|