C22H21BrFN4O5S- — CID 66782670
4-[[5-bromo-6-(4-fluorophenoxy)-3-pyridinyl]-sulfinatoamino]-1-(2-ethoxy-2-oxoethyl)-4,5,6,7-tetrahydroindazole (PubChem CID 66782670) has the molecular formula C22H21BrFN4O5S- and a molecular weight of 552.40 g/mol. Its IUPAC name is 4-[[5-bromo-6-(4-fluorophenoxy)-3-pyridinyl]-sulfinatoamino]-1-(2-ethoxy-2-oxoethyl)-4,5,6,7-tetrahydroindazole.
| Compound Name | 4-[[5-bromo-6-(4-fluorophenoxy)-3-pyridinyl]-sulfinatoamino]-1-(2-ethoxy-2-oxoethyl)-4,5,6,7-tetrahydroindazole |
|---|---|
| PubChem CID | 66782670 |
| Molecular Formula | C22H21BrFN4O5S- |
| Molecular Weight | 552.40 g/mol |
| Exact Mass | 551.04 |
| IUPAC Name | 4-[[5-bromo-6-(4-fluorophenoxy)-3-pyridinyl]-sulfinatoamino]-1-(2-ethoxy-2-oxoethyl)-4,5,6,7-tetrahydroindazole |
| SMILES | CCOC(=O)Cn1ncc2c1CCCC2N(c1cnc(Oc2ccc(F)cc2)c(Br)c1)S(=O)[O-] |
| InChI | InChI=1S/C22H22BrFN4O5S/c1-2-32-21(29)13-27-19-4-3-5-20(17(19)12-26-27)28(34(30)31)15-10-18(23)22(25-11-15)33-16-8-6-14(24)7-9-16/h6-12,20H,2-5,13H2,1H3,(H,30,31)/p-1 |
| InChIKey | DCGUHBGHCRHVOP-UHFFFAOYSA-M |
| XLogP | 4.21 |
| TPSA | 109.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|