C34H44N4O8S — CID 66782782
13-cyclohexyl-6-[(2R,6S)-2,6-dimethylmorpholine-4-carbonyl]-N-(dimethylsulfamoyl)-5,6-dihydroxy-3-methoxy-5,7-dihydroindolo[2,1-a][2]benzazepine-10-carboxamide (PubChem CID 66782782) has the molecular formula C34H44N4O8S and a molecular weight of 668.81 g/mol. Its IUPAC name is 13-cyclohexyl-6-[(2R,6S)-2,6-dimethylmorpholine-4-carbonyl]-N-(dimethylsulfamoyl)-5,6-dihydroxy-3-methoxy-5,7-dihydroindolo[2,1-a][2]benzazepine-10-carboxamide.
| Compound Name | 13-cyclohexyl-6-[(2R,6S)-2,6-dimethylmorpholine-4-carbonyl]-N-(dimethylsulfamoyl)-5,6-dihydroxy-3-methoxy-5,7-dihydroindolo[2,1-a][2]benzazepine-10-carboxamide |
|---|---|
| PubChem CID | 66782782 |
| Molecular Formula | C34H44N4O8S |
| Molecular Weight | 668.81 g/mol |
| Exact Mass | 668.29 |
| IUPAC Name | 13-cyclohexyl-6-[(2R,6S)-2,6-dimethylmorpholine-4-carbonyl]-N-(dimethylsulfamoyl)-5,6-dihydroxy-3-methoxy-5,7-dihydroindolo[2,1-a][2]benzazepine-10-carboxamide |
| SMILES | COc1ccc2c(c1)C(O)C(O)(C(=O)N1C[C@@H](C)O[C@@H](C)C1)Cn1c-2c(C2CCCCC2)c2ccc(C(=O)NS(=O)(=O)N(C)C)cc21 |
| InChI | InChI=1S/C34H44N4O8S/c1-20-17-37(18-21(2)46-20)33(41)34(42)19-38-28-15-23(32(40)35-47(43,44)36(3)4)11-13-26(28)29(22-9-7-6-8-10-22)30(38)25-14-12-24(45-5)16-27(25)31(34)39/h11-16,20-22,31,39,42H,6-10,17-19H2,1-5H3,(H,35,40)/t20-,21+,31?,34? |
| InChIKey | PJCISQWSNCHOOG-YCRSNGTLSA-N |
| XLogP | 3.31 |
| TPSA | 150.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.81 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |