C30H51Cl2N3O4Si — CID 66782809
N-[3-[8-[tert-butyl(dimethyl)silyl]oxy-6-azaspiro[2.5]octan-6-yl]propyl]-2-(3,4-dichloroanilino)-N-(2,2-dimethoxyethyl)butanamide (PubChem CID 66782809) has the molecular formula C30H51Cl2N3O4Si and a molecular weight of 616.75 g/mol. Its IUPAC name is N-[3-[8-[tert-butyl(dimethyl)silyl]oxy-6-azaspiro[2.5]octan-6-yl]propyl]-2-(3,4-dichloroanilino)-N-(2,2-dimethoxyethyl)butanamide.
| Compound Name | N-[3-[8-[tert-butyl(dimethyl)silyl]oxy-6-azaspiro[2.5]octan-6-yl]propyl]-2-(3,4-dichloroanilino)-N-(2,2-dimethoxyethyl)butanamide |
|---|---|
| PubChem CID | 66782809 |
| Molecular Formula | C30H51Cl2N3O4Si |
| Molecular Weight | 616.75 g/mol |
| Exact Mass | 615.30 |
| IUPAC Name | N-[3-[8-[tert-butyl(dimethyl)silyl]oxy-6-azaspiro[2.5]octan-6-yl]propyl]-2-(3,4-dichloroanilino)-N-(2,2-dimethoxyethyl)butanamide |
| SMILES | CCC(Nc1ccc(Cl)c(Cl)c1)C(=O)N(CCCN1CCC2(CC2)C(O[Si](C)(C)C(C)(C)C)C1)CC(OC)OC |
| InChI | InChI=1S/C30H51Cl2N3O4Si/c1-9-25(33-22-11-12-23(31)24(32)19-22)28(36)35(21-27(37-5)38-6)17-10-16-34-18-15-30(13-14-30)26(20-34)39-40(7,8)29(2,3)4/h11-12,19,25-27,33H,9-10,13-18,20-21H2,1-8H3 |
| InChIKey | UNADOOOCQWGPJX-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.75 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|