About 2-(1H-indol-3-yl)acetamide;N-[2-(1H-indol-3-yl)ethyl]benzenesulfonamide
2-(1H-indol-3-yl)acetamide;N-[2-(1H-indol-3-yl)ethyl]benzenesulfonamide (PubChem CID 66783092) has the molecular formula C26H26N4O3S
and a molecular weight of 474.59 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)acetamide;N-[2-(1H-indol-3-yl)ethyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 2-(1H-indol-3-yl)acetamide;N-[2-(1H-indol-3-yl)ethyl]benzenesulfonamide |
| PubChem CID | 66783092 |
| Molecular Formula | C26H26N4O3S |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 2-(1H-indol-3-yl)acetamide;N-[2-(1H-indol-3-yl)ethyl]benzenesulfonamide |
| SMILES | NC(=O)Cc1c[nH]c2ccccc12.O=S(=O)(NCCc1c[nH]c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C16H16N2O2S.C10H10N2O/c19-21(20,14-6-2-1-3-7-14)18-11-10-13-12-17-16-9-5-4-8-15(13)16;11-10(13)5-7-6-12-9-4-2-1-3-8(7)9/h1-9,12,17-18H,10-11H2;1-4,6,12H,5H2,(H2,11,13) |
| InChIKey | KZQWYUIGOSFUTP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1H-indol-3-yl)acetamide;N-[2-(1H-indol-3-yl)ethyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-indol-3-yl)acetamide;N-[2-(1H-indol-3-yl)ethyl]benzenesulfonamide?
The IUPAC name of 2-(1H-indol-3-yl)acetamide;N-[2-(1H-indol-3-yl)ethyl]benzenesulfonamide (CID 66783092) is 2-(1H-indol-3-yl)acetamide;N-[2-(1H-indol-3-yl)ethyl]benzenesulfonamide.
What is the SMILES notation for 2-(1H-indol-3-yl)acetamide;N-[2-(1H-indol-3-yl)ethyl]benzenesulfonamide?
The canonical SMILES for 2-(1H-indol-3-yl)acetamide;N-[2-(1H-indol-3-yl)ethyl]benzenesulfonamide is NC(=O)Cc1c[nH]c2ccccc12.O=S(=O)(NCCc1c[nH]c2ccccc12)c1ccccc1.
What is the InChIKey of 2-(1H-indol-3-yl)acetamide;N-[2-(1H-indol-3-yl)ethyl]benzenesulfonamide?
The InChIKey is KZQWYUIGOSFUTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O2S.C10H10N2O/c19-21(20,14-6-2-1-3-7-14)18-11-10-13-12-17-16-9-5-4-8-15(13)16;11-10(13)5-7-6-12-9-4-2-1-3-8(7)9/h1-9,12,17-18H,10-11H2;1-4,6,12H,5H2,(H2,11,13).
What are the key properties of 2-(1H-indol-3-yl)acetamide;N-[2-(1H-indol-3-yl)ethyl]benzenesulfonamide?
2-(1H-indol-3-yl)acetamide;N-[2-(1H-indol-3-yl)ethyl]benzenesulfonamide has a molecular weight of 474.59 g/mol, XLogP of 3.88, 7 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-indol-3-yl)acetamide;N-[2-(1H-indol-3-yl)ethyl]benzenesulfonamide is sourced from PubChem (CID 66783092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).