About 5-(3-oxo-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)pyridine-3-carbonitrile
5-(3-oxo-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)pyridine-3-carbonitrile (PubChem CID 66783531) has the molecular formula C14H16N4O2
and a molecular weight of 272.31 g/mol. Its IUPAC name is 5-(3-oxo-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 5-(3-oxo-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)pyridine-3-carbonitrile |
| PubChem CID | 66783531 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 5-(3-oxo-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)pyridine-3-carbonitrile |
| SMILES | N#Cc1cncc(N2CC3(CCNCC3)OCC2=O)c1 |
| InChI | InChI=1S/C14H16N4O2/c15-6-11-5-12(8-17-7-11)18-10-14(20-9-13(18)19)1-3-16-4-2-14/h5,7-8,16H,1-4,9-10H2 |
| InChIKey | LZXKVMOXHZHKLD-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(3-oxo-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-oxo-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)pyridine-3-carbonitrile?
The IUPAC name of 5-(3-oxo-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)pyridine-3-carbonitrile (CID 66783531) is 5-(3-oxo-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)pyridine-3-carbonitrile.
What is the SMILES notation for 5-(3-oxo-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)pyridine-3-carbonitrile?
The canonical SMILES for 5-(3-oxo-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)pyridine-3-carbonitrile is N#Cc1cncc(N2CC3(CCNCC3)OCC2=O)c1.
What is the InChIKey of 5-(3-oxo-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)pyridine-3-carbonitrile?
The InChIKey is LZXKVMOXHZHKLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4O2/c15-6-11-5-12(8-17-7-11)18-10-14(20-9-13(18)19)1-3-16-4-2-14/h5,7-8,16H,1-4,9-10H2.
What are the key properties of 5-(3-oxo-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)pyridine-3-carbonitrile?
5-(3-oxo-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)pyridine-3-carbonitrile has a molecular weight of 272.31 g/mol, XLogP of 0.44, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-oxo-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)pyridine-3-carbonitrile is sourced from PubChem (CID 66783531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).