C30H37N5O3 — CID 66783557
9-[4-(1-cyclobutylpiperidin-4-yl)oxyphenyl]-4-imidazo[1,2-a]pyridin-3-yl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one (PubChem CID 66783557) has the molecular formula C30H37N5O3 and a molecular weight of 515.66 g/mol. Its IUPAC name is 9-[4-(1-cyclobutylpiperidin-4-yl)oxyphenyl]-4-imidazo[1,2-a]pyridin-3-yl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one.
| Compound Name | 9-[4-(1-cyclobutylpiperidin-4-yl)oxyphenyl]-4-imidazo[1,2-a]pyridin-3-yl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 66783557 |
| Molecular Formula | C30H37N5O3 |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.29 |
| IUPAC Name | 9-[4-(1-cyclobutylpiperidin-4-yl)oxyphenyl]-4-imidazo[1,2-a]pyridin-3-yl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
| SMILES | O=C1COC2(CCN(c3ccc(OC4CCN(C5CCC5)CC4)cc3)CC2)CN1c1cnc2ccccn12 |
| InChI | InChI=1S/C30H37N5O3/c36-29-21-37-30(22-35(29)28-20-31-27-6-1-2-15-34(27)28)13-18-33(19-14-30)24-7-9-25(10-8-24)38-26-11-16-32(17-12-26)23-4-3-5-23/h1-2,6-10,15,20,23,26H,3-5,11-14,16-19,21-22H2 |
| InChIKey | NMZOSALJUBQMPC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 62.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|