About 5-phenyl-6H-1,3,4-thiadiazin-2-amine
5-phenyl-6H-1,3,4-thiadiazin-2-amine (PubChem CID 667837) has the molecular formula C9H9N3S
and a molecular weight of 191.26 g/mol. Its IUPAC name is 5-phenyl-6H-1,3,4-thiadiazin-2-amine.
Molecular Properties
| Compound Name | 5-phenyl-6H-1,3,4-thiadiazin-2-amine |
| PubChem CID | 667837 |
| Molecular Formula | C9H9N3S |
| Molecular Weight | 191.26 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | 5-phenyl-6H-1,3,4-thiadiazin-2-amine |
| SMILES | NC1=NN=C(c2ccccc2)CS1 |
| InChI | InChI=1S/C9H9N3S/c10-9-12-11-8(6-13-9)7-4-2-1-3-5-7/h1-5H,6H2,(H2,10,12) |
| InChIKey | SCQDMIFRQDAQPV-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.26 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-phenyl-6H-1,3,4-thiadiazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-6H-1,3,4-thiadiazin-2-amine?
The IUPAC name of 5-phenyl-6H-1,3,4-thiadiazin-2-amine (CID 667837) is 5-phenyl-6H-1,3,4-thiadiazin-2-amine.
What is the SMILES notation for 5-phenyl-6H-1,3,4-thiadiazin-2-amine?
The canonical SMILES for 5-phenyl-6H-1,3,4-thiadiazin-2-amine is NC1=NN=C(c2ccccc2)CS1.
What is the InChIKey of 5-phenyl-6H-1,3,4-thiadiazin-2-amine?
The InChIKey is SCQDMIFRQDAQPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3S/c10-9-12-11-8(6-13-9)7-4-2-1-3-5-7/h1-5H,6H2,(H2,10,12).
What are the key properties of 5-phenyl-6H-1,3,4-thiadiazin-2-amine?
5-phenyl-6H-1,3,4-thiadiazin-2-amine has a molecular weight of 191.26 g/mol, XLogP of 1.45, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-6H-1,3,4-thiadiazin-2-amine is sourced from PubChem (CID 667837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).