About furo[3,2-d]pyrimidine;5H-pyrrolo[3,2-d]pyrimidine
furo[3,2-d]pyrimidine;5H-pyrrolo[3,2-d]pyrimidine (PubChem CID 66783956) has the molecular formula C12H9N5O
and a molecular weight of 239.24 g/mol. Its IUPAC name is furo[3,2-d]pyrimidine;5H-pyrrolo[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | furo[3,2-d]pyrimidine;5H-pyrrolo[3,2-d]pyrimidine |
| PubChem CID | 66783956 |
| Molecular Formula | C12H9N5O |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | furo[3,2-d]pyrimidine;5H-pyrrolo[3,2-d]pyrimidine |
| SMILES | c1ncc2[nH]ccc2n1.c1ncc2occc2n1 |
| InChI | InChI=1S/C6H5N3.C6H4N2O/c1-2-8-6-3-7-4-9-5(1)6;1-2-9-6-3-7-4-8-5(1)6/h1-4,8H;1-4H |
| InChIKey | IVFLNHLVLLCFNZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze furo[3,2-d]pyrimidine;5H-pyrrolo[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furo[3,2-d]pyrimidine;5H-pyrrolo[3,2-d]pyrimidine?
The IUPAC name of furo[3,2-d]pyrimidine;5H-pyrrolo[3,2-d]pyrimidine (CID 66783956) is furo[3,2-d]pyrimidine;5H-pyrrolo[3,2-d]pyrimidine.
What is the SMILES notation for furo[3,2-d]pyrimidine;5H-pyrrolo[3,2-d]pyrimidine?
The canonical SMILES for furo[3,2-d]pyrimidine;5H-pyrrolo[3,2-d]pyrimidine is c1ncc2[nH]ccc2n1.c1ncc2occc2n1.
What is the InChIKey of furo[3,2-d]pyrimidine;5H-pyrrolo[3,2-d]pyrimidine?
The InChIKey is IVFLNHLVLLCFNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3.C6H4N2O/c1-2-8-6-3-7-4-9-5(1)6;1-2-9-6-3-7-4-8-5(1)6/h1-4,8H;1-4H.
What are the key properties of furo[3,2-d]pyrimidine;5H-pyrrolo[3,2-d]pyrimidine?
furo[3,2-d]pyrimidine;5H-pyrrolo[3,2-d]pyrimidine has a molecular weight of 239.24 g/mol, XLogP of 2.18, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for furo[3,2-d]pyrimidine;5H-pyrrolo[3,2-d]pyrimidine is sourced from PubChem (CID 66783956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).