About 1-propyl-1H-imidazol-1-ium;tetrachloroalumanuide
1-propyl-1H-imidazol-1-ium;tetrachloroalumanuide (PubChem CID 66783958) has the molecular formula C6H11AlCl4N2
and a molecular weight of 279.96 g/mol. Its IUPAC name is 1-propyl-1H-imidazol-1-ium;tetrachloroalumanuide.
Molecular Properties
| Compound Name | 1-propyl-1H-imidazol-1-ium;tetrachloroalumanuide |
| PubChem CID | 66783958 |
| Molecular Formula | C6H11AlCl4N2 |
| Molecular Weight | 279.96 g/mol |
| Exact Mass | 277.95 |
| IUPAC Name | 1-propyl-1H-imidazol-1-ium;tetrachloroalumanuide |
| SMILES | CCC[NH+]1C=CN=C1.Cl[Al-](Cl)(Cl)Cl |
| InChI | InChI=1S/C6H10N2.Al.4ClH/c1-2-4-8-5-3-7-6-8;;;;;/h3,5-6H,2,4H2,1H3;;4*1H/q;+3;;;;/p-3 |
| InChIKey | BFADPNRWDQKWFI-UHFFFAOYSA-K |
| XLogP | 2.17 |
| TPSA | 16.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.96 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-propyl-1H-imidazol-1-ium;tetrachloroalumanuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propyl-1H-imidazol-1-ium;tetrachloroalumanuide?
The IUPAC name of 1-propyl-1H-imidazol-1-ium;tetrachloroalumanuide (CID 66783958) is 1-propyl-1H-imidazol-1-ium;tetrachloroalumanuide.
What is the SMILES notation for 1-propyl-1H-imidazol-1-ium;tetrachloroalumanuide?
The canonical SMILES for 1-propyl-1H-imidazol-1-ium;tetrachloroalumanuide is CCC[NH+]1C=CN=C1.Cl[Al-](Cl)(Cl)Cl.
What is the InChIKey of 1-propyl-1H-imidazol-1-ium;tetrachloroalumanuide?
The InChIKey is BFADPNRWDQKWFI-UHFFFAOYSA-K. The full InChI is InChI=1S/C6H10N2.Al.4ClH/c1-2-4-8-5-3-7-6-8;;;;;/h3,5-6H,2,4H2,1H3;;4*1H/q;+3;;;;/p-3.
What are the key properties of 1-propyl-1H-imidazol-1-ium;tetrachloroalumanuide?
1-propyl-1H-imidazol-1-ium;tetrachloroalumanuide has a molecular weight of 279.96 g/mol, XLogP of 2.17, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propyl-1H-imidazol-1-ium;tetrachloroalumanuide is sourced from PubChem (CID 66783958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).