C13H14INOS — CID 66784068
(4-iodo-2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridin-3-yl)methanol (PubChem CID 66784068) has the molecular formula C13H14INOS and a molecular weight of 359.23 g/mol. Its IUPAC name is (4-iodo-2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridin-3-yl)methanol.
| Compound Name | (4-iodo-2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridin-3-yl)methanol |
|---|---|
| PubChem CID | 66784068 |
| Molecular Formula | C13H14INOS |
| Molecular Weight | 359.23 g/mol |
| Exact Mass | 358.98 |
| IUPAC Name | (4-iodo-2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridin-3-yl)methanol |
| SMILES | Cc1nc2sc3c(c2c(I)c1CO)CCCC3 |
| InChI | InChI=1S/C13H14INOS/c1-7-9(6-16)12(14)11-8-4-2-3-5-10(8)17-13(11)15-7/h16H,2-6H2,1H3 |
| InChIKey | KOLBOXKTUKNLAU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.23 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|