C21H39NO2 — CID 66784085
carbamic acid;(1S,3R,4R,8S,11S,12R)-4,8,12,15,15-pentamethyltricyclo[9.3.1.03,8]pentadecane (PubChem CID 66784085) has the molecular formula C21H39NO2 and a molecular weight of 337.55 g/mol. Its IUPAC name is carbamic acid;(1S,3R,4R,8S,11S,12R)-4,8,12,15,15-pentamethyltricyclo[9.3.1.03,8]pentadecane.
| Compound Name | carbamic acid;(1S,3R,4R,8S,11S,12R)-4,8,12,15,15-pentamethyltricyclo[9.3.1.03,8]pentadecane |
|---|---|
| PubChem CID | 66784085 |
| Molecular Formula | C21H39NO2 |
| Molecular Weight | 337.55 g/mol |
| Exact Mass | 337.30 |
| IUPAC Name | carbamic acid;(1S,3R,4R,8S,11S,12R)-4,8,12,15,15-pentamethyltricyclo[9.3.1.03,8]pentadecane |
| SMILES | C[C@@H]1CCC[C@@]2(C)CC[C@H]3[C@H](C)CC[C@@H](C[C@H]12)C3(C)C.NC(=O)O |
| InChI | InChI=1S/C20H36.CH3NO2/c1-14-7-6-11-20(5)12-10-17-15(2)8-9-16(13-18(14)20)19(17,3)4;2-1(3)4/h14-18H,6-13H2,1-5H3;2H2,(H,3,4)/t14-,15-,16+,17+,18-,20+;/m1./s1 |
| InChIKey | CYXVQOFUNYBTJR-GTHBOGNNSA-N |
| XLogP | 5.92 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.55 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |