About methyl 3-(cycloheptanecarbonylamino)-3-(oxan-4-yl)-2-oxopropanoate;2-propan-2-yloxypropane
methyl 3-(cycloheptanecarbonylamino)-3-(oxan-4-yl)-2-oxopropanoate;2-propan-2-yloxypropane (PubChem CID 66784531) has the molecular formula C23H41NO6
and a molecular weight of 427.58 g/mol. Its IUPAC name is methyl 3-(cycloheptanecarbonylamino)-3-(oxan-4-yl)-2-oxopropanoate;2-propan-2-yloxypropane.
Molecular Properties
| Compound Name | methyl 3-(cycloheptanecarbonylamino)-3-(oxan-4-yl)-2-oxopropanoate;2-propan-2-yloxypropane |
| PubChem CID | 66784531 |
| Molecular Formula | C23H41NO6 |
| Molecular Weight | 427.58 g/mol |
| Exact Mass | 427.29 |
| IUPAC Name | methyl 3-(cycloheptanecarbonylamino)-3-(oxan-4-yl)-2-oxopropanoate;2-propan-2-yloxypropane |
| SMILES | CC(C)OC(C)C.COC(=O)C(=O)C(NC(=O)C1CCCCCC1)C1CCOCC1 |
| InChI | InChI=1S/C17H27NO5.C6H14O/c1-22-17(21)15(19)14(12-8-10-23-11-9-12)18-16(20)13-6-4-2-3-5-7-13;1-5(2)7-6(3)4/h12-14H,2-11H2,1H3,(H,18,20);5-6H,1-4H3 |
| InChIKey | YQPYJURGCADWCV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.58 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(cycloheptanecarbonylamino)-3-(oxan-4-yl)-2-oxopropanoate;2-propan-2-yloxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(cycloheptanecarbonylamino)-3-(oxan-4-yl)-2-oxopropanoate;2-propan-2-yloxypropane?
The IUPAC name of methyl 3-(cycloheptanecarbonylamino)-3-(oxan-4-yl)-2-oxopropanoate;2-propan-2-yloxypropane (CID 66784531) is methyl 3-(cycloheptanecarbonylamino)-3-(oxan-4-yl)-2-oxopropanoate;2-propan-2-yloxypropane.
What is the SMILES notation for methyl 3-(cycloheptanecarbonylamino)-3-(oxan-4-yl)-2-oxopropanoate;2-propan-2-yloxypropane?
The canonical SMILES for methyl 3-(cycloheptanecarbonylamino)-3-(oxan-4-yl)-2-oxopropanoate;2-propan-2-yloxypropane is CC(C)OC(C)C.COC(=O)C(=O)C(NC(=O)C1CCCCCC1)C1CCOCC1.
What is the InChIKey of methyl 3-(cycloheptanecarbonylamino)-3-(oxan-4-yl)-2-oxopropanoate;2-propan-2-yloxypropane?
The InChIKey is YQPYJURGCADWCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NO5.C6H14O/c1-22-17(21)15(19)14(12-8-10-23-11-9-12)18-16(20)13-6-4-2-3-5-7-13;1-5(2)7-6(3)4/h12-14H,2-11H2,1H3,(H,18,20);5-6H,1-4H3.
What are the key properties of methyl 3-(cycloheptanecarbonylamino)-3-(oxan-4-yl)-2-oxopropanoate;2-propan-2-yloxypropane?
methyl 3-(cycloheptanecarbonylamino)-3-(oxan-4-yl)-2-oxopropanoate;2-propan-2-yloxypropane has a molecular weight of 427.58 g/mol, XLogP of 3.43, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(cycloheptanecarbonylamino)-3-(oxan-4-yl)-2-oxopropanoate;2-propan-2-yloxypropane is sourced from PubChem (CID 66784531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).