About ethoxyethane;2-oxopyrrolidine-1-carboxylic acid
ethoxyethane;2-oxopyrrolidine-1-carboxylic acid (PubChem CID 66784725) has the molecular formula C9H17NO4
and a molecular weight of 203.24 g/mol. Its IUPAC name is ethoxyethane;2-oxopyrrolidine-1-carboxylic acid.
Molecular Properties
| Compound Name | ethoxyethane;2-oxopyrrolidine-1-carboxylic acid |
| PubChem CID | 66784725 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | ethoxyethane;2-oxopyrrolidine-1-carboxylic acid |
| SMILES | CCOCC.O=C(O)N1CCCC1=O |
| InChI | InChI=1S/C5H7NO3.C4H10O/c7-4-2-1-3-6(4)5(8)9;1-3-5-4-2/h1-3H2,(H,8,9);3-4H2,1-2H3 |
| InChIKey | UKNULHKNHGNMSS-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethoxyethane;2-oxopyrrolidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxyethane;2-oxopyrrolidine-1-carboxylic acid?
The IUPAC name of ethoxyethane;2-oxopyrrolidine-1-carboxylic acid (CID 66784725) is ethoxyethane;2-oxopyrrolidine-1-carboxylic acid.
What is the SMILES notation for ethoxyethane;2-oxopyrrolidine-1-carboxylic acid?
The canonical SMILES for ethoxyethane;2-oxopyrrolidine-1-carboxylic acid is CCOCC.O=C(O)N1CCCC1=O.
What is the InChIKey of ethoxyethane;2-oxopyrrolidine-1-carboxylic acid?
The InChIKey is UKNULHKNHGNMSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO3.C4H10O/c7-4-2-1-3-6(4)5(8)9;1-3-5-4-2/h1-3H2,(H,8,9);3-4H2,1-2H3.
What are the key properties of ethoxyethane;2-oxopyrrolidine-1-carboxylic acid?
ethoxyethane;2-oxopyrrolidine-1-carboxylic acid has a molecular weight of 203.24 g/mol, XLogP of 1.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxyethane;2-oxopyrrolidine-1-carboxylic acid is sourced from PubChem (CID 66784725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).