C12H20O6 — CID 66784802
(1S,2R,4S,5R)-4,5-dimethoxy-1,2-dimethylcyclohexane-1,2-dicarboxylic acid (PubChem CID 66784802) has the molecular formula C12H20O6 and a molecular weight of 260.29 g/mol. Its IUPAC name is (1S,2R,4S,5R)-4,5-dimethoxy-1,2-dimethylcyclohexane-1,2-dicarboxylic acid.
| Compound Name | (1S,2R,4S,5R)-4,5-dimethoxy-1,2-dimethylcyclohexane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 66784802 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (1S,2R,4S,5R)-4,5-dimethoxy-1,2-dimethylcyclohexane-1,2-dicarboxylic acid |
| SMILES | CO[C@H]1C[C@@](C)(C(=O)O)[C@@](C)(C(=O)O)C[C@H]1OC |
| InChI | InChI=1S/C12H20O6/c1-11(9(13)14)5-7(17-3)8(18-4)6-12(11,2)10(15)16/h7-8H,5-6H2,1-4H3,(H,13,14)(H,15,16)/t7-,8+,11-,12+ |
| InChIKey | IEFLZYMAACAHHJ-ZTCHHREXSA-N |
| XLogP | 0.99 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |