C22H23F3N2O5S — CID 66785720
3-(5-ethyl-2-methoxyphenyl)sulfonyl-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene;2,2,2-trifluoroacetic acid (PubChem CID 66785720) has the molecular formula C22H23F3N2O5S and a molecular weight of 484.50 g/mol. Its IUPAC name is 3-(5-ethyl-2-methoxyphenyl)sulfonyl-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene;2,2,2-trifluoroacetic acid.
| Compound Name | 3-(5-ethyl-2-methoxyphenyl)sulfonyl-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66785720 |
| Molecular Formula | C22H23F3N2O5S |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | 3-(5-ethyl-2-methoxyphenyl)sulfonyl-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene;2,2,2-trifluoroacetic acid |
| SMILES | CCc1ccc(OC)c(S(=O)(=O)n2cc3c4c(cccc42)CNCC3)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H22N2O3S.C2HF3O2/c1-3-14-7-8-18(25-2)19(11-14)26(23,24)22-13-16-9-10-21-12-15-5-4-6-17(22)20(15)16;3-2(4,5)1(6)7/h4-8,11,13,21H,3,9-10,12H2,1-2H3;(H,6,7) |
| InChIKey | SJPGCVLEUQLUTK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |