C21H35ClN4O4S — CID 66785854
4,4-dimethyl-N-[1-(oxan-4-yl)-2,3-dioxo-3-[2-(3,4,4-trimethyl-1,3-thiazolidin-2-ylidene)hydrazinyl]propyl]pent-2-enamide;hydrochloride (PubChem CID 66785854) has the molecular formula C21H35ClN4O4S and a molecular weight of 475.06 g/mol. Its IUPAC name is 4,4-dimethyl-N-[1-(oxan-4-yl)-2,3-dioxo-3-[2-(3,4,4-trimethyl-1,3-thiazolidin-2-ylidene)hydrazinyl]propyl]pent-2-enamide;hydrochloride.
| Compound Name | 4,4-dimethyl-N-[1-(oxan-4-yl)-2,3-dioxo-3-[2-(3,4,4-trimethyl-1,3-thiazolidin-2-ylidene)hydrazinyl]propyl]pent-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 66785854 |
| Molecular Formula | C21H35ClN4O4S |
| Molecular Weight | 475.06 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 4,4-dimethyl-N-[1-(oxan-4-yl)-2,3-dioxo-3-[2-(3,4,4-trimethyl-1,3-thiazolidin-2-ylidene)hydrazinyl]propyl]pent-2-enamide;hydrochloride |
| SMILES | CN1C(=NNC(=O)C(=O)C(NC(=O)C=CC(C)(C)C)C2CCOCC2)SCC1(C)C.Cl |
| InChI | InChI=1S/C21H34N4O4S.ClH/c1-20(2,3)10-7-15(26)22-16(14-8-11-29-12-9-14)17(27)18(28)23-24-19-25(6)21(4,5)13-30-19;/h7,10,14,16H,8-9,11-13H2,1-6H3,(H,22,26)(H,23,28);1H |
| InChIKey | GZTFQQBQGHVHRL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.06 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|