C26H25ClN4O4S — CID 66785866
ethyl 3-[[4-(chloromethyl)benzoyl]amino]-5-(2-phenylpropan-2-ylcarbamoyl)thieno[3,2-d]pyrazole-1-carboxylate (PubChem CID 66785866) has the molecular formula C26H25ClN4O4S and a molecular weight of 525.03 g/mol. Its IUPAC name is ethyl 3-[[4-(chloromethyl)benzoyl]amino]-5-(2-phenylpropan-2-ylcarbamoyl)thieno[3,2-d]pyrazole-1-carboxylate.
| Compound Name | ethyl 3-[[4-(chloromethyl)benzoyl]amino]-5-(2-phenylpropan-2-ylcarbamoyl)thieno[3,2-d]pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 66785866 |
| Molecular Formula | C26H25ClN4O4S |
| Molecular Weight | 525.03 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | ethyl 3-[[4-(chloromethyl)benzoyl]amino]-5-(2-phenylpropan-2-ylcarbamoyl)thieno[3,2-d]pyrazole-1-carboxylate |
| SMILES | CCOC(=O)n1nc(NC(=O)c2ccc(CCl)cc2)c2cc(C(=O)NC(C)(C)c3ccccc3)sc21 |
| InChI | InChI=1S/C26H25ClN4O4S/c1-4-35-25(34)31-24-19(21(30-31)28-22(32)17-12-10-16(15-27)11-13-17)14-20(36-24)23(33)29-26(2,3)18-8-6-5-7-9-18/h5-14H,4,15H2,1-3H3,(H,29,33)(H,28,30,32) |
| InChIKey | YMZSRTOJVLBDJP-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.03 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|