About 1-[(2S,4R)-4-anilino-2-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone
1-[(2S,4R)-4-anilino-2-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone (PubChem CID 667862) has the molecular formula C18H20N2O
and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-[(2S,4R)-4-anilino-2-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[(2S,4R)-4-anilino-2-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone |
| PubChem CID | 667862 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 1-[(2S,4R)-4-anilino-2-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone |
| SMILES | CC(=O)N1c2ccccc2[C@H](Nc2ccccc2)C[C@@H]1C |
| InChI | InChI=1S/C18H20N2O/c1-13-12-17(19-15-8-4-3-5-9-15)16-10-6-7-11-18(16)20(13)14(2)21/h3-11,13,17,19H,12H2,1-2H3/t13-,17+/m0/s1 |
| InChIKey | NPJVGQHTXJHUEL-SUMWQHHRSA-N |
| XLogP | 3.98 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(2S,4R)-4-anilino-2-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S,4R)-4-anilino-2-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone?
The IUPAC name of 1-[(2S,4R)-4-anilino-2-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone (CID 667862) is 1-[(2S,4R)-4-anilino-2-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone.
What is the SMILES notation for 1-[(2S,4R)-4-anilino-2-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone?
The canonical SMILES for 1-[(2S,4R)-4-anilino-2-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone is CC(=O)N1c2ccccc2[C@H](Nc2ccccc2)C[C@@H]1C.
What is the InChIKey of 1-[(2S,4R)-4-anilino-2-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone?
The InChIKey is NPJVGQHTXJHUEL-SUMWQHHRSA-N. The full InChI is InChI=1S/C18H20N2O/c1-13-12-17(19-15-8-4-3-5-9-15)16-10-6-7-11-18(16)20(13)14(2)21/h3-11,13,17,19H,12H2,1-2H3/t13-,17+/m0/s1.
What are the key properties of 1-[(2S,4R)-4-anilino-2-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone?
1-[(2S,4R)-4-anilino-2-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone has a molecular weight of 280.37 g/mol, XLogP of 3.98, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S,4R)-4-anilino-2-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone is sourced from PubChem (CID 667862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).