About (1S,5R)-3,8-diazabicyclo[3.2.1]octane-3-carboxamide;hydrochloride
(1S,5R)-3,8-diazabicyclo[3.2.1]octane-3-carboxamide;hydrochloride (PubChem CID 66786242) has the molecular formula C7H14ClN3O
and a molecular weight of 191.66 g/mol. Its IUPAC name is (1S,5R)-3,8-diazabicyclo[3.2.1]octane-3-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | (1S,5R)-3,8-diazabicyclo[3.2.1]octane-3-carboxamide;hydrochloride |
| PubChem CID | 66786242 |
| Molecular Formula | C7H14ClN3O |
| Molecular Weight | 191.66 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | (1S,5R)-3,8-diazabicyclo[3.2.1]octane-3-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)N1C[C@H]2CC[C@@H](C1)N2 |
| InChI | InChI=1S/C7H13N3O.ClH/c8-7(11)10-3-5-1-2-6(4-10)9-5;/h5-6,9H,1-4H2,(H2,8,11);1H/t5-,6+; |
| InChIKey | BDQYOEWQVMPAKI-KNCHESJLSA-N |
| XLogP | -0.08 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.66 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S,5R)-3,8-diazabicyclo[3.2.1]octane-3-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5R)-3,8-diazabicyclo[3.2.1]octane-3-carboxamide;hydrochloride?
The IUPAC name of (1S,5R)-3,8-diazabicyclo[3.2.1]octane-3-carboxamide;hydrochloride (CID 66786242) is (1S,5R)-3,8-diazabicyclo[3.2.1]octane-3-carboxamide;hydrochloride.
What is the SMILES notation for (1S,5R)-3,8-diazabicyclo[3.2.1]octane-3-carboxamide;hydrochloride?
The canonical SMILES for (1S,5R)-3,8-diazabicyclo[3.2.1]octane-3-carboxamide;hydrochloride is Cl.NC(=O)N1C[C@H]2CC[C@@H](C1)N2.
What is the InChIKey of (1S,5R)-3,8-diazabicyclo[3.2.1]octane-3-carboxamide;hydrochloride?
The InChIKey is BDQYOEWQVMPAKI-KNCHESJLSA-N. The full InChI is InChI=1S/C7H13N3O.ClH/c8-7(11)10-3-5-1-2-6(4-10)9-5;/h5-6,9H,1-4H2,(H2,8,11);1H/t5-,6+;.
What are the key properties of (1S,5R)-3,8-diazabicyclo[3.2.1]octane-3-carboxamide;hydrochloride?
(1S,5R)-3,8-diazabicyclo[3.2.1]octane-3-carboxamide;hydrochloride has a molecular weight of 191.66 g/mol, XLogP of -0.08, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5R)-3,8-diazabicyclo[3.2.1]octane-3-carboxamide;hydrochloride is sourced from PubChem (CID 66786242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).