C21H21F3N2O5S — CID 66786250
3-(2-methoxy-6-methylphenyl)sulfonyl-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene;2,2,2-trifluoroacetic acid (PubChem CID 66786250) has the molecular formula C21H21F3N2O5S and a molecular weight of 470.47 g/mol. Its IUPAC name is 3-(2-methoxy-6-methylphenyl)sulfonyl-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene;2,2,2-trifluoroacetic acid.
| Compound Name | 3-(2-methoxy-6-methylphenyl)sulfonyl-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66786250 |
| Molecular Formula | C21H21F3N2O5S |
| Molecular Weight | 470.47 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | 3-(2-methoxy-6-methylphenyl)sulfonyl-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene;2,2,2-trifluoroacetic acid |
| SMILES | COc1cccc(C)c1S(=O)(=O)n1cc2c3c(cccc31)CNCC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H20N2O3S.C2HF3O2/c1-13-5-3-8-17(24-2)19(13)25(22,23)21-12-15-9-10-20-11-14-6-4-7-16(21)18(14)15;3-2(4,5)1(6)7/h3-8,12,20H,9-11H2,1-2H3;(H,6,7) |
| InChIKey | SOYHJYJFTADONO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |