About 3-methyl-4-[[5-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1-benzofuran-2-yl]methyl]morpholine
3-methyl-4-[[5-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1-benzofuran-2-yl]methyl]morpholine (PubChem CID 66787020) has the molecular formula C20H19N3O3S
and a molecular weight of 381.46 g/mol. Its IUPAC name is 3-methyl-4-[[5-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1-benzofuran-2-yl]methyl]morpholine.
Molecular Properties
| Compound Name | 3-methyl-4-[[5-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1-benzofuran-2-yl]methyl]morpholine |
| PubChem CID | 66787020 |
| Molecular Formula | C20H19N3O3S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 3-methyl-4-[[5-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1-benzofuran-2-yl]methyl]morpholine |
| SMILES | CC1COCCN1Cc1cc2cc(Oc3nc4ncccc4s3)ccc2o1 |
| InChI | InChI=1S/C20H19N3O3S/c1-13-12-24-8-7-23(13)11-16-10-14-9-15(4-5-17(14)25-16)26-20-22-19-18(27-20)3-2-6-21-19/h2-6,9-10,13H,7-8,11-12H2,1H3 |
| InChIKey | CCNYCPBLJMZZJU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 60.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-methyl-4-[[5-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1-benzofuran-2-yl]methyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-[[5-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1-benzofuran-2-yl]methyl]morpholine?
The IUPAC name of 3-methyl-4-[[5-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1-benzofuran-2-yl]methyl]morpholine (CID 66787020) is 3-methyl-4-[[5-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1-benzofuran-2-yl]methyl]morpholine.
What is the SMILES notation for 3-methyl-4-[[5-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1-benzofuran-2-yl]methyl]morpholine?
The canonical SMILES for 3-methyl-4-[[5-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1-benzofuran-2-yl]methyl]morpholine is CC1COCCN1Cc1cc2cc(Oc3nc4ncccc4s3)ccc2o1.
What is the InChIKey of 3-methyl-4-[[5-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1-benzofuran-2-yl]methyl]morpholine?
The InChIKey is CCNYCPBLJMZZJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O3S/c1-13-12-24-8-7-23(13)11-16-10-14-9-15(4-5-17(14)25-16)26-20-22-19-18(27-20)3-2-6-21-19/h2-6,9-10,13H,7-8,11-12H2,1H3.
What are the key properties of 3-methyl-4-[[5-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1-benzofuran-2-yl]methyl]morpholine?
3-methyl-4-[[5-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1-benzofuran-2-yl]methyl]morpholine has a molecular weight of 381.46 g/mol, XLogP of 4.45, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-[[5-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)-1-benzofuran-2-yl]methyl]morpholine is sourced from PubChem (CID 66787020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).