C27H25N3O4S — CID 66787554
formic acid;2-[[3-[(4-phenylpiperidin-1-yl)methyl]-1-benzofuran-6-yl]oxy]-[1,3]thiazolo[4,5-b]pyridine (PubChem CID 66787554) has the molecular formula C27H25N3O4S and a molecular weight of 487.58 g/mol. Its IUPAC name is formic acid;2-[[3-[(4-phenylpiperidin-1-yl)methyl]-1-benzofuran-6-yl]oxy]-[1,3]thiazolo[4,5-b]pyridine.
| Compound Name | formic acid;2-[[3-[(4-phenylpiperidin-1-yl)methyl]-1-benzofuran-6-yl]oxy]-[1,3]thiazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 66787554 |
| Molecular Formula | C27H25N3O4S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | formic acid;2-[[3-[(4-phenylpiperidin-1-yl)methyl]-1-benzofuran-6-yl]oxy]-[1,3]thiazolo[4,5-b]pyridine |
| SMILES | O=CO.c1ccc(C2CCN(Cc3coc4cc(Oc5nc6ncccc6s5)ccc34)CC2)cc1 |
| InChI | InChI=1S/C26H23N3O2S.CH2O2/c1-2-5-18(6-3-1)19-10-13-29(14-11-19)16-20-17-30-23-15-21(8-9-22(20)23)31-26-28-25-24(32-26)7-4-12-27-25;2-1-3/h1-9,12,15,17,19H,10-11,13-14,16H2;1H,(H,2,3) |
| InChIKey | YXBZGOFJLZJTIE-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|