About 3-(fluoromethyl)pyrrolidine-1,3-dicarboxylic acid
3-(fluoromethyl)pyrrolidine-1,3-dicarboxylic acid (PubChem CID 66787783) has the molecular formula C7H10FNO4
and a molecular weight of 191.16 g/mol. Its IUPAC name is 3-(fluoromethyl)pyrrolidine-1,3-dicarboxylic acid.
Molecular Properties
| Compound Name | 3-(fluoromethyl)pyrrolidine-1,3-dicarboxylic acid |
| PubChem CID | 66787783 |
| Molecular Formula | C7H10FNO4 |
| Molecular Weight | 191.16 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 3-(fluoromethyl)pyrrolidine-1,3-dicarboxylic acid |
| SMILES | O=C(O)N1CCC(CF)(C(=O)O)C1 |
| InChI | InChI=1S/C7H10FNO4/c8-3-7(5(10)11)1-2-9(4-7)6(12)13/h1-4H2,(H,10,11)(H,12,13) |
| InChIKey | KVEAEAJBHWYOGW-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.16 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(fluoromethyl)pyrrolidine-1,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(fluoromethyl)pyrrolidine-1,3-dicarboxylic acid?
The IUPAC name of 3-(fluoromethyl)pyrrolidine-1,3-dicarboxylic acid (CID 66787783) is 3-(fluoromethyl)pyrrolidine-1,3-dicarboxylic acid.
What is the SMILES notation for 3-(fluoromethyl)pyrrolidine-1,3-dicarboxylic acid?
The canonical SMILES for 3-(fluoromethyl)pyrrolidine-1,3-dicarboxylic acid is O=C(O)N1CCC(CF)(C(=O)O)C1.
What is the InChIKey of 3-(fluoromethyl)pyrrolidine-1,3-dicarboxylic acid?
The InChIKey is KVEAEAJBHWYOGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10FNO4/c8-3-7(5(10)11)1-2-9(4-7)6(12)13/h1-4H2,(H,10,11)(H,12,13).
What are the key properties of 3-(fluoromethyl)pyrrolidine-1,3-dicarboxylic acid?
3-(fluoromethyl)pyrrolidine-1,3-dicarboxylic acid has a molecular weight of 191.16 g/mol, XLogP of 0.41, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(fluoromethyl)pyrrolidine-1,3-dicarboxylic acid is sourced from PubChem (CID 66787783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).