(5-cyano-1-benzofuran-2-yl)boronic acid

C9H6BNO3 — CID 66787891

IUPAC(5-cyano-1-benzofuran-2-yl)boronic acid
SMILESN#Cc1ccc2oc(B(O)O)cc2c1
InChIInChI=1S/C9H6BNO3/c11-5-6-1-2-8-7(3-6)4-9(14-8)10(12)13/h1-4,12-13H
InChIKeyMXLRCFQFPPZZOR-UHFFFAOYSA-N
MW186.96 g/mol
LogP-0.02
Rot. Bonds1

About (5-cyano-1-benzofuran-2-yl)boronic acid

(5-cyano-1-benzofuran-2-yl)boronic acid (PubChem CID 66787891) has the molecular formula C9H6BNO3 and a molecular weight of 186.96 g/mol. Its IUPAC name is (5-cyano-1-benzofuran-2-yl)boronic acid.

Molecular Properties

Compound Name(5-cyano-1-benzofuran-2-yl)boronic acid
PubChem CID66787891
Molecular FormulaC9H6BNO3
Molecular Weight186.96 g/mol
Exact Mass187.04
IUPAC Name(5-cyano-1-benzofuran-2-yl)boronic acid
SMILESN#Cc1ccc2oc(B(O)O)cc2c1
InChIInChI=1S/C9H6BNO3/c11-5-6-1-2-8-7(3-6)4-9(14-8)10(12)13/h1-4,12-13H
InChIKeyMXLRCFQFPPZZOR-UHFFFAOYSA-N
XLogP-0.02
TPSA77.39 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.96
LogP ≤ 5-0.02
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (5-cyano-1-benzofuran-2-yl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5-cyano-1-benzofuran-2-yl)boronic acid?
The IUPAC name of (5-cyano-1-benzofuran-2-yl)boronic acid (CID 66787891) is (5-cyano-1-benzofuran-2-yl)boronic acid.
What is the SMILES notation for (5-cyano-1-benzofuran-2-yl)boronic acid?
The canonical SMILES for (5-cyano-1-benzofuran-2-yl)boronic acid is N#Cc1ccc2oc(B(O)O)cc2c1.
What is the InChIKey of (5-cyano-1-benzofuran-2-yl)boronic acid?
The InChIKey is MXLRCFQFPPZZOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BNO3/c11-5-6-1-2-8-7(3-6)4-9(14-8)10(12)13/h1-4,12-13H.
What are the key properties of (5-cyano-1-benzofuran-2-yl)boronic acid?
(5-cyano-1-benzofuran-2-yl)boronic acid has a molecular weight of 186.96 g/mol, XLogP of -0.02, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-cyano-1-benzofuran-2-yl)boronic acid is sourced from PubChem (CID 66787891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).