About (4-ethyl-2,4-diphenyl-1,3-dioxolan-2-yl)methanol
(4-ethyl-2,4-diphenyl-1,3-dioxolan-2-yl)methanol (PubChem CID 66787940) has the molecular formula C18H20O3
and a molecular weight of 284.36 g/mol. Its IUPAC name is (4-ethyl-2,4-diphenyl-1,3-dioxolan-2-yl)methanol.
Molecular Properties
| Compound Name | (4-ethyl-2,4-diphenyl-1,3-dioxolan-2-yl)methanol |
| PubChem CID | 66787940 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (4-ethyl-2,4-diphenyl-1,3-dioxolan-2-yl)methanol |
| SMILES | CCC1(c2ccccc2)COC(CO)(c2ccccc2)O1 |
| InChI | InChI=1S/C18H20O3/c1-2-17(15-9-5-3-6-10-15)14-20-18(13-19,21-17)16-11-7-4-8-12-16/h3-12,19H,2,13-14H2,1H3 |
| InChIKey | LUOQZHHDZFDUMY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-ethyl-2,4-diphenyl-1,3-dioxolan-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethyl-2,4-diphenyl-1,3-dioxolan-2-yl)methanol?
The IUPAC name of (4-ethyl-2,4-diphenyl-1,3-dioxolan-2-yl)methanol (CID 66787940) is (4-ethyl-2,4-diphenyl-1,3-dioxolan-2-yl)methanol.
What is the SMILES notation for (4-ethyl-2,4-diphenyl-1,3-dioxolan-2-yl)methanol?
The canonical SMILES for (4-ethyl-2,4-diphenyl-1,3-dioxolan-2-yl)methanol is CCC1(c2ccccc2)COC(CO)(c2ccccc2)O1.
What is the InChIKey of (4-ethyl-2,4-diphenyl-1,3-dioxolan-2-yl)methanol?
The InChIKey is LUOQZHHDZFDUMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O3/c1-2-17(15-9-5-3-6-10-15)14-20-18(13-19,21-17)16-11-7-4-8-12-16/h3-12,19H,2,13-14H2,1H3.
What are the key properties of (4-ethyl-2,4-diphenyl-1,3-dioxolan-2-yl)methanol?
(4-ethyl-2,4-diphenyl-1,3-dioxolan-2-yl)methanol has a molecular weight of 284.36 g/mol, XLogP of 3.18, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethyl-2,4-diphenyl-1,3-dioxolan-2-yl)methanol is sourced from PubChem (CID 66787940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).