C27H33F3IN7O2 — CID 66787970
1-(1-iodopropan-2-yl)-4-[3-[4-[1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidin-4-yl]phenoxy]propyl]piperazin-2-one (PubChem CID 66787970) has the molecular formula C27H33F3IN7O2 and a molecular weight of 671.51 g/mol. Its IUPAC name is 1-(1-iodopropan-2-yl)-4-[3-[4-[1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidin-4-yl]phenoxy]propyl]piperazin-2-one.
| Compound Name | 1-(1-iodopropan-2-yl)-4-[3-[4-[1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidin-4-yl]phenoxy]propyl]piperazin-2-one |
|---|---|
| PubChem CID | 66787970 |
| Molecular Formula | C27H33F3IN7O2 |
| Molecular Weight | 671.51 g/mol |
| Exact Mass | 671.17 |
| IUPAC Name | 1-(1-iodopropan-2-yl)-4-[3-[4-[1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidin-4-yl]phenoxy]propyl]piperazin-2-one |
| SMILES | CC(CI)N1CCN(CCCOc2ccc(C3CCN(c4ccc5nnc(C(F)(F)F)n5n4)CC3)cc2)CC1=O |
| InChI | InChI=1S/C27H33F3IN7O2/c1-19(17-31)37-15-14-35(18-25(37)39)11-2-16-40-22-5-3-20(4-6-22)21-9-12-36(13-10-21)24-8-7-23-32-33-26(27(28,29)30)38(23)34-24/h3-8,19,21H,2,9-18H2,1H3 |
| InChIKey | KHEZZVAGGKRGHX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 79.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.51 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|