C46H46N6O6 — CID 66787976
bis[5-[6-[(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)oxy]-3-pyridinyl]-1H-indol-3-yl] (E)-but-2-enedioate (PubChem CID 66787976) has the molecular formula C46H46N6O6 and a molecular weight of 778.91 g/mol. Its IUPAC name is bis[5-[6-[(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)oxy]-3-pyridinyl]-1H-indol-3-yl] (E)-but-2-enedioate.
| Compound Name | bis[5-[6-[(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)oxy]-3-pyridinyl]-1H-indol-3-yl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 66787976 |
| Molecular Formula | C46H46N6O6 |
| Molecular Weight | 778.91 g/mol |
| Exact Mass | 778.35 |
| IUPAC Name | bis[5-[6-[(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)oxy]-3-pyridinyl]-1H-indol-3-yl] (E)-but-2-enedioate |
| SMILES | CN1C2CCC1CC(Oc1ccc(-c3ccc4[nH]cc(OC(=O)/C=C/C(=O)Oc5c[nH]c6ccc(-c7ccc(OC8CC9CCC(C8)N9C)nc7)cc56)c4c3)cn1)C2 |
| InChI | InChI=1S/C46H46N6O6/c1-51-31-7-8-32(51)20-35(19-31)55-43-13-5-29(23-49-43)27-3-11-39-37(17-27)41(25-47-39)57-45(53)15-16-46(54)58-42-26-48-40-12-4-28(18-38(40)42)30-6-14-44(50-24-30)56-36-21-33-9-10-34(22-36)52(33)2/h3-6,11-18,23-26,31-36,47-48H,7-10,19-22H2,1-2H3/b16-15+ |
| InChIKey | HYDNLHVQGXNVGU-FOCLMDBBSA-N |
| XLogP | 7.85 |
| TPSA | 134.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.91 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|