5-(2,2-difluoroethyl)-1H-pyrazole-4-carboxylic acid

C6H6F2N2O2 — CID 66788035

IUPAC5-(2,2-difluoroethyl)-1H-pyrazole-4-carboxylic acid
SMILESO=C(O)c1cn[nH]c1CC(F)F
InChIInChI=1S/C6H6F2N2O2/c7-5(8)1-4-3(6(11)12)2-9-10-4/h2,5H,1H2,(H,9,10)(H,11,12)
InChIKeyQRXAXVLKNZFKKH-UHFFFAOYSA-N
MW176.12 g/mol
LogP0.92
Rot. Bonds3

About 5-(2,2-difluoroethyl)-1H-pyrazole-4-carboxylic acid

5-(2,2-difluoroethyl)-1H-pyrazole-4-carboxylic acid (PubChem CID 66788035) has the molecular formula C6H6F2N2O2 and a molecular weight of 176.12 g/mol. Its IUPAC name is 5-(2,2-difluoroethyl)-1H-pyrazole-4-carboxylic acid.

Molecular Properties

Compound Name5-(2,2-difluoroethyl)-1H-pyrazole-4-carboxylic acid
PubChem CID66788035
Molecular FormulaC6H6F2N2O2
Molecular Weight176.12 g/mol
Exact Mass176.04
IUPAC Name5-(2,2-difluoroethyl)-1H-pyrazole-4-carboxylic acid
SMILESO=C(O)c1cn[nH]c1CC(F)F
InChIInChI=1S/C6H6F2N2O2/c7-5(8)1-4-3(6(11)12)2-9-10-4/h2,5H,1H2,(H,9,10)(H,11,12)
InChIKeyQRXAXVLKNZFKKH-UHFFFAOYSA-N
XLogP0.92
TPSA65.98 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500176.12
LogP ≤ 50.92
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 5-(2,2-difluoroethyl)-1H-pyrazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2,2-difluoroethyl)-1H-pyrazole-4-carboxylic acid?
The IUPAC name of 5-(2,2-difluoroethyl)-1H-pyrazole-4-carboxylic acid (CID 66788035) is 5-(2,2-difluoroethyl)-1H-pyrazole-4-carboxylic acid.
What is the SMILES notation for 5-(2,2-difluoroethyl)-1H-pyrazole-4-carboxylic acid?
The canonical SMILES for 5-(2,2-difluoroethyl)-1H-pyrazole-4-carboxylic acid is O=C(O)c1cn[nH]c1CC(F)F.
What is the InChIKey of 5-(2,2-difluoroethyl)-1H-pyrazole-4-carboxylic acid?
The InChIKey is QRXAXVLKNZFKKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6F2N2O2/c7-5(8)1-4-3(6(11)12)2-9-10-4/h2,5H,1H2,(H,9,10)(H,11,12).
What are the key properties of 5-(2,2-difluoroethyl)-1H-pyrazole-4-carboxylic acid?
5-(2,2-difluoroethyl)-1H-pyrazole-4-carboxylic acid has a molecular weight of 176.12 g/mol, XLogP of 0.92, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-difluoroethyl)-1H-pyrazole-4-carboxylic acid is sourced from PubChem (CID 66788035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).