C16H15Cl2NO — CID 66788063
4-(3,4-dichlorophenyl)-7-methoxy-1,2,3,4-tetrahydroisoquinoline (PubChem CID 66788063) has the molecular formula C16H15Cl2NO and a molecular weight of 308.21 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-7-methoxy-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 4-(3,4-dichlorophenyl)-7-methoxy-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 66788063 |
| Molecular Formula | C16H15Cl2NO |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-7-methoxy-1,2,3,4-tetrahydroisoquinoline |
| SMILES | COc1ccc2c(c1)CNCC2c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H15Cl2NO/c1-20-12-3-4-13-11(6-12)8-19-9-14(13)10-2-5-15(17)16(18)7-10/h2-7,14,19H,8-9H2,1H3 |
| InChIKey | XAZDWYUYONZKJN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |