C9H16N6O — CID 66788334
3-prop-2-enoxyprop-1-ene;1,3,5-triazine-2,4,6-triamine (PubChem CID 66788334) has the molecular formula C9H16N6O and a molecular weight of 224.27 g/mol. Its IUPAC name is 3-prop-2-enoxyprop-1-ene;1,3,5-triazine-2,4,6-triamine.
| Compound Name | 3-prop-2-enoxyprop-1-ene;1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 66788334 |
| Molecular Formula | C9H16N6O |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 3-prop-2-enoxyprop-1-ene;1,3,5-triazine-2,4,6-triamine |
| SMILES | C=CCOCC=C.Nc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C6H10O.C3H6N6/c1-3-5-7-6-4-2;4-1-7-2(5)9-3(6)8-1/h3-4H,1-2,5-6H2;(H6,4,5,6,7,8,9) |
| InChIKey | DJSRYUOEHKOPJN-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 125.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|