C22H22ClF3N4O — CID 66788427
1'-[8-chloro-3-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[4,3-a]pyridin-7-yl]-3,3-dimethylspiro[2-benzofuran-1,4'-piperidine] (PubChem CID 66788427) has the molecular formula C22H22ClF3N4O and a molecular weight of 450.89 g/mol. Its IUPAC name is 1'-[8-chloro-3-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[4,3-a]pyridin-7-yl]-3,3-dimethylspiro[2-benzofuran-1,4'-piperidine].
| Compound Name | 1'-[8-chloro-3-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[4,3-a]pyridin-7-yl]-3,3-dimethylspiro[2-benzofuran-1,4'-piperidine] |
|---|---|
| PubChem CID | 66788427 |
| Molecular Formula | C22H22ClF3N4O |
| Molecular Weight | 450.89 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 1'-[8-chloro-3-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[4,3-a]pyridin-7-yl]-3,3-dimethylspiro[2-benzofuran-1,4'-piperidine] |
| SMILES | CC1(C)OC2(CCN(c3ccn4c(CC(F)(F)F)nnc4c3Cl)CC2)c2ccccc21 |
| InChI | InChI=1S/C22H22ClF3N4O/c1-20(2)14-5-3-4-6-15(14)21(31-20)8-11-29(12-9-21)16-7-10-30-17(13-22(24,25)26)27-28-19(30)18(16)23/h3-7,10H,8-9,11-13H2,1-2H3 |
| InChIKey | ZJNHONRUINSMBV-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 42.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.89 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |