C14H23N3O6 — CID 66788956
methyl 2-acetyl-3-[2-(methoxycarbonylamino)-3-methylbutanoyl]imidazolidine-4-carboxylate (PubChem CID 66788956) has the molecular formula C14H23N3O6 and a molecular weight of 329.35 g/mol. Its IUPAC name is methyl 2-acetyl-3-[2-(methoxycarbonylamino)-3-methylbutanoyl]imidazolidine-4-carboxylate.
| Compound Name | methyl 2-acetyl-3-[2-(methoxycarbonylamino)-3-methylbutanoyl]imidazolidine-4-carboxylate |
|---|---|
| PubChem CID | 66788956 |
| Molecular Formula | C14H23N3O6 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | methyl 2-acetyl-3-[2-(methoxycarbonylamino)-3-methylbutanoyl]imidazolidine-4-carboxylate |
| SMILES | COC(=O)NC(C(=O)N1C(C(=O)OC)CNC1C(C)=O)C(C)C |
| InChI | InChI=1S/C14H23N3O6/c1-7(2)10(16-14(21)23-5)12(19)17-9(13(20)22-4)6-15-11(17)8(3)18/h7,9-11,15H,6H2,1-5H3,(H,16,21) |
| InChIKey | TUCKNXOAINGJOS-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |