About 2-O-[2-(4-bromophenyl)-2-oxoethyl] 1-O-tert-butyl 4-(difluoromethoxymethyl)pyrrolidine-1,2-dicarboxylate
2-O-[2-(4-bromophenyl)-2-oxoethyl] 1-O-tert-butyl 4-(difluoromethoxymethyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 66788989) has the molecular formula C20H24BrF2NO6
and a molecular weight of 492.31 g/mol. Its IUPAC name is 2-O-[2-(4-bromophenyl)-2-oxoethyl] 1-O-tert-butyl 4-(difluoromethoxymethyl)pyrrolidine-1,2-dicarboxylate.
Molecular Properties
| Compound Name | 2-O-[2-(4-bromophenyl)-2-oxoethyl] 1-O-tert-butyl 4-(difluoromethoxymethyl)pyrrolidine-1,2-dicarboxylate |
| PubChem CID | 66788989 |
| Molecular Formula | C20H24BrF2NO6 |
| Molecular Weight | 492.31 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | 2-O-[2-(4-bromophenyl)-2-oxoethyl] 1-O-tert-butyl 4-(difluoromethoxymethyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(COC(F)F)CC1C(=O)OCC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H24BrF2NO6/c1-20(2,3)30-19(27)24-9-12(10-29-18(22)23)8-15(24)17(26)28-11-16(25)13-4-6-14(21)7-5-13/h4-7,12,15,18H,8-11H2,1-3H3 |
| InChIKey | MCGOIXKEHDNAIR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 492.31 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-O-[2-(4-bromophenyl)-2-oxoethyl] 1-O-tert-butyl 4-(difluoromethoxymethyl)pyrrolidine-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-[2-(4-bromophenyl)-2-oxoethyl] 1-O-tert-butyl 4-(difluoromethoxymethyl)pyrrolidine-1,2-dicarboxylate?
The IUPAC name of 2-O-[2-(4-bromophenyl)-2-oxoethyl] 1-O-tert-butyl 4-(difluoromethoxymethyl)pyrrolidine-1,2-dicarboxylate (CID 66788989) is 2-O-[2-(4-bromophenyl)-2-oxoethyl] 1-O-tert-butyl 4-(difluoromethoxymethyl)pyrrolidine-1,2-dicarboxylate.
What is the SMILES notation for 2-O-[2-(4-bromophenyl)-2-oxoethyl] 1-O-tert-butyl 4-(difluoromethoxymethyl)pyrrolidine-1,2-dicarboxylate?
The canonical SMILES for 2-O-[2-(4-bromophenyl)-2-oxoethyl] 1-O-tert-butyl 4-(difluoromethoxymethyl)pyrrolidine-1,2-dicarboxylate is CC(C)(C)OC(=O)N1CC(COC(F)F)CC1C(=O)OCC(=O)c1ccc(Br)cc1.
What is the InChIKey of 2-O-[2-(4-bromophenyl)-2-oxoethyl] 1-O-tert-butyl 4-(difluoromethoxymethyl)pyrrolidine-1,2-dicarboxylate?
The InChIKey is MCGOIXKEHDNAIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24BrF2NO6/c1-20(2,3)30-19(27)24-9-12(10-29-18(22)23)8-15(24)17(26)28-11-16(25)13-4-6-14(21)7-5-13/h4-7,12,15,18H,8-11H2,1-3H3.
What are the key properties of 2-O-[2-(4-bromophenyl)-2-oxoethyl] 1-O-tert-butyl 4-(difluoromethoxymethyl)pyrrolidine-1,2-dicarboxylate?
2-O-[2-(4-bromophenyl)-2-oxoethyl] 1-O-tert-butyl 4-(difluoromethoxymethyl)pyrrolidine-1,2-dicarboxylate has a molecular weight of 492.31 g/mol, XLogP of 4.04, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-[2-(4-bromophenyl)-2-oxoethyl] 1-O-tert-butyl 4-(difluoromethoxymethyl)pyrrolidine-1,2-dicarboxylate is sourced from PubChem (CID 66788989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).