About 7-bromo-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine
7-bromo-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine (PubChem CID 66789061) has the molecular formula C7H7BrN2O
and a molecular weight of 215.05 g/mol. Its IUPAC name is 7-bromo-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine.
Molecular Properties
| Compound Name | 7-bromo-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine |
| PubChem CID | 66789061 |
| Molecular Formula | C7H7BrN2O |
| Molecular Weight | 215.05 g/mol |
| Exact Mass | 213.97 |
| IUPAC Name | 7-bromo-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine |
| SMILES | Brc1cnc2c(c1)NCCO2 |
| InChI | InChI=1S/C7H7BrN2O/c8-5-3-6-7(10-4-5)11-2-1-9-6/h3-4,9H,1-2H2 |
| InChIKey | FFQNNPQQIUKLGV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.05 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-bromo-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine?
The IUPAC name of 7-bromo-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine (CID 66789061) is 7-bromo-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine.
What is the SMILES notation for 7-bromo-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine?
The canonical SMILES for 7-bromo-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine is Brc1cnc2c(c1)NCCO2.
What is the InChIKey of 7-bromo-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine?
The InChIKey is FFQNNPQQIUKLGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrN2O/c8-5-3-6-7(10-4-5)11-2-1-9-6/h3-4,9H,1-2H2.
What are the key properties of 7-bromo-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine?
7-bromo-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine has a molecular weight of 215.05 g/mol, XLogP of 1.65, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine is sourced from PubChem (CID 66789061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).