C19H18FNO4 — CID 66789715
3-[4-[(4-fluorophenyl)methyl]furan-2-carbonyl]-4-hydroxy-1-propan-2-yl-2H-pyrrol-5-one (PubChem CID 66789715) has the molecular formula C19H18FNO4 and a molecular weight of 343.35 g/mol. Its IUPAC name is 3-[4-[(4-fluorophenyl)methyl]furan-2-carbonyl]-4-hydroxy-1-propan-2-yl-2H-pyrrol-5-one.
| Compound Name | 3-[4-[(4-fluorophenyl)methyl]furan-2-carbonyl]-4-hydroxy-1-propan-2-yl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 66789715 |
| Molecular Formula | C19H18FNO4 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 3-[4-[(4-fluorophenyl)methyl]furan-2-carbonyl]-4-hydroxy-1-propan-2-yl-2H-pyrrol-5-one |
| SMILES | CC(C)N1CC(C(=O)c2cc(Cc3ccc(F)cc3)co2)=C(O)C1=O |
| InChI | InChI=1S/C19H18FNO4/c1-11(2)21-9-15(18(23)19(21)24)17(22)16-8-13(10-25-16)7-12-3-5-14(20)6-4-12/h3-6,8,10-11,23H,7,9H2,1-2H3 |
| InChIKey | WUDOLUMFZFVNSD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |