About 7-amino-4-(4-fluorophenyl)-5-(hydroxymethyl)-2,2-dimethyl-1,4-benzoxazin-3-one
7-amino-4-(4-fluorophenyl)-5-(hydroxymethyl)-2,2-dimethyl-1,4-benzoxazin-3-one (PubChem CID 66790065) has the molecular formula C17H17FN2O3
and a molecular weight of 316.33 g/mol. Its IUPAC name is 7-amino-4-(4-fluorophenyl)-5-(hydroxymethyl)-2,2-dimethyl-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 7-amino-4-(4-fluorophenyl)-5-(hydroxymethyl)-2,2-dimethyl-1,4-benzoxazin-3-one |
| PubChem CID | 66790065 |
| Molecular Formula | C17H17FN2O3 |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 7-amino-4-(4-fluorophenyl)-5-(hydroxymethyl)-2,2-dimethyl-1,4-benzoxazin-3-one |
| SMILES | CC1(C)Oc2cc(N)cc(CO)c2N(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C17H17FN2O3/c1-17(2)16(22)20(13-5-3-11(18)4-6-13)15-10(9-21)7-12(19)8-14(15)23-17/h3-8,21H,9,19H2,1-2H3 |
| InChIKey | VSADXRVYTCFFCR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-4-(4-fluorophenyl)-5-(hydroxymethyl)-2,2-dimethyl-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-4-(4-fluorophenyl)-5-(hydroxymethyl)-2,2-dimethyl-1,4-benzoxazin-3-one?
The IUPAC name of 7-amino-4-(4-fluorophenyl)-5-(hydroxymethyl)-2,2-dimethyl-1,4-benzoxazin-3-one (CID 66790065) is 7-amino-4-(4-fluorophenyl)-5-(hydroxymethyl)-2,2-dimethyl-1,4-benzoxazin-3-one.
What is the SMILES notation for 7-amino-4-(4-fluorophenyl)-5-(hydroxymethyl)-2,2-dimethyl-1,4-benzoxazin-3-one?
The canonical SMILES for 7-amino-4-(4-fluorophenyl)-5-(hydroxymethyl)-2,2-dimethyl-1,4-benzoxazin-3-one is CC1(C)Oc2cc(N)cc(CO)c2N(c2ccc(F)cc2)C1=O.
What is the InChIKey of 7-amino-4-(4-fluorophenyl)-5-(hydroxymethyl)-2,2-dimethyl-1,4-benzoxazin-3-one?
The InChIKey is VSADXRVYTCFFCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17FN2O3/c1-17(2)16(22)20(13-5-3-11(18)4-6-13)15-10(9-21)7-12(19)8-14(15)23-17/h3-8,21H,9,19H2,1-2H3.
What are the key properties of 7-amino-4-(4-fluorophenyl)-5-(hydroxymethyl)-2,2-dimethyl-1,4-benzoxazin-3-one?
7-amino-4-(4-fluorophenyl)-5-(hydroxymethyl)-2,2-dimethyl-1,4-benzoxazin-3-one has a molecular weight of 316.33 g/mol, XLogP of 2.74, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-4-(4-fluorophenyl)-5-(hydroxymethyl)-2,2-dimethyl-1,4-benzoxazin-3-one is sourced from PubChem (CID 66790065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).