C17H19FN2O — CID 66790154
4-(4-fluorophenyl)-2,2,5-trimethyl-3H-1,4-benzoxazin-7-amine (PubChem CID 66790154) has the molecular formula C17H19FN2O and a molecular weight of 286.35 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-2,2,5-trimethyl-3H-1,4-benzoxazin-7-amine.
| Compound Name | 4-(4-fluorophenyl)-2,2,5-trimethyl-3H-1,4-benzoxazin-7-amine |
|---|---|
| PubChem CID | 66790154 |
| Molecular Formula | C17H19FN2O |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 4-(4-fluorophenyl)-2,2,5-trimethyl-3H-1,4-benzoxazin-7-amine |
| SMILES | Cc1cc(N)cc2c1N(c1ccc(F)cc1)CC(C)(C)O2 |
| InChI | InChI=1S/C17H19FN2O/c1-11-8-13(19)9-15-16(11)20(10-17(2,3)21-15)14-6-4-12(18)5-7-14/h4-9H,10,19H2,1-3H3 |
| InChIKey | PWYXQNLIILPBCC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|